On Target TAAR1_HUMAN 0.5272727/CHEMBL1379139
For the given ligand Tramadol, we have found in our database that, being scored 0.5272727, the most similar ligand is CHEMBL1379139. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1379139 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | Cl.O=C(CCN1CCCC1Cc2ccccc2)c3ccc4OCCOc4c3 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04000000 43000a08 2010010b 00210600 00001000 40000010 02040200 20000000 00002880 000808c0 08300000 40019000 0880c002 20200080 01204001 200c8008 00000000 02000000 00082012 00020201 00000100 18220210 04000000 89500014 00001000 80000000 00120000 10800000 04000202 0006000a 80000000 00022600 |