On Target HRH3_HUMAN 0.7093023/CHEMBL2375598
For the given ligand Tramadol, we have found in our database that, being scored 0.7093023, the most similar ligand is CHEMBL2375598. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL2375598 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | OC1(CCCCC1)c2ccc(OCCCN3CCCCC3)cc2 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04000000 01000008 2010010a 00010600 00081000 02004000 02040000 20000000 00000900 000808c0 08300000 50018000 00800002 00a00000 01000001 00082008 00200000 02000000 02c02000 00020201 00000100 18000020 01000080 00500010 00000001 80000000 00520000 10000000 00000202 00060002 40020000 00002640 |