On Target DRD5_HUMAN 0.5555556/CHEMBL231171
For the given ligand Tramadol, we have found in our database that, being scored 0.5555556, the most similar ligand is CHEMBL231171. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL231171 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1ccc2Cc3ccccc3CCCN(C)CCCc2c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 42000208 20100108 00010600 00001000 40000002 02040400 21000001 04000800 000808c0 08300000 40008000 00000002 20200000 01000001 02040008 00000000 02000000 00180000 00020201 00000100 18000000 00004000 00400010 00000000 a0000001 00120000 50000000 02000280 0006000a 00000000 00002600 |