On Target NPFF1_HUMAN 0.4030612/CHEMBL2208312
For the given ligand Molecule, we have found in our database that, being scored 0.4030612, the most similar ligand is CHEMBL2208312. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL2208312 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | NC(=N)NCCC[C@H](NC(=O)c1ccc2ccccc2n1)C(=O)N[C@@H](Cc3ccccc3)C(=O)N |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00018002 01003a00 00104100 14010e00 00040020 00100000 00000000 2200300d 00200a80 000908c2 08390004 4003b000 06009812 00502001 80020440 02140104 00000000 02000002 00200008 00000201 40000100 38278628 20802003 8350001c 00100800 c0000000 40000040 90000000 0c000114 0006000b a00c4000 00006600 |