On Target EDNRA_HUMAN 0.36309522/CHEMBL343379
For the given ligand Captagon, we have found in our database that, being scored 0.36309522, the most similar ligand is CHEMBL343379. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL343379 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | CC[C@H](C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 00030002 01003a00 00100100 45810610 001c1200 00000000 00002000 2000000c 00400880 000b08c0 08300004 4001b000 1e008832 01402801 80000040 000c000c 00000000 02000000 00600408 00000201 40000100 38248e08 21800003 93500018 00043800 80000000 08000000 10000000 0c000000 0006000b 20044200 00802e20 |