On Target V1AR_HUMAN 0.41566265/CHEMBL3416878
For the given ligand Captagon, we have found in our database that, being scored 0.41566265, the most similar ligand is CHEMBL3416878. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL3416878 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | Clc1ccc2c(c[nH]c2c1)C(=O)N3CCC(CC3)N4C(=O)Nc5ccccc45 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 10018002 01801c00 00100100 00010610 000c1040 00004080 04004000 22001004 04200100 800009e0 0d20800c 50018800 02009806 01c40000 003004c0 000c0004 00120008 02000000 00600000 00000201 c0000000 180e8f38 21800001 8070001c 00046000 c0000000 08000000 90000000 00000100 00460011 e00c8200 804202a0 |