On Target OPRM_HUMAN 0.4964029/CHEMBL1423
For the given ligand Captagon, we have found in our database that, being scored 0.4964029, the most similar ligand is CHEMBL1423. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL1423 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | Fc1ccc(cc1)C(CCCN2CCC(CC2)N3C(=O)Nc4ccccc34)c5ccc(F)cc5 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 00000002 01000400 00100102 02010600 000c0040 00004090 00000000 21000000 04300900 800809e0 0d30800c 50018000 00009002 01e41000 003000c0 000c0004 00100000 02000080 00600000 00100201 c0000100 18000030 21800001 00700010 00000000 e0000000 00000000 50000001 00000080 00468012 40080000 00002680 |