On Target MC4R_HUMAN 0.41621622/CHEMBL4108637
For the given ligand Captagon, we have found in our database that, being scored 0.41621622, the most similar ligand is CHEMBL4108637. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL4108637 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | CC(=O)N[C@@H](CCCCN)C(=O)N[C@H]1CCCNC(=O)CC[C@H](NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](Cc4ccccc4)NC(=O)[C@H](C[n+]5cc[nH]c5)NC1=O)C(=O)N |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 00030002 01003e00 00100100 45810e10 001e1240 00100000 00002000 2000200c 00600b80 000b09c2 0830900c 4003b000 1e00981a 01c42801 800008c0 001c0004 00100000 02000000 00602408 00000201 c0000100 38258638 21800003 93500018 00043800 80000000 48400000 10000000 0c000010 0046001b e00c4200 00802e20 |