On Target NPY4R_HUMAN 0.33507854/CHEMBL2440191
For the given ligand Captagon, we have found in our database that, being scored 0.33507854, the most similar ligand is CHEMBL2440191. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL2440191 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CCCNC(=N)N)NC(=O)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H]3CC[C@H]3C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H]4CC[C@H]4C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc5ccc(O)cc5)C(=O)N |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 04030002 01003608 20100100 05810e10 04000240 00000000 02002020 2000200c 00600b80 00090be2 28308000 5003b800 0e009012 00102811 81020000 001c000c 00000000 0e000001 00000018 40020201 20000d00 382d0620 21000003 93500018 00041800 80000200 40120000 10000100 0c000016 0046001b e0084000 20802600 |