On Target ACM3_HUMAN 0.5857143/CHEMBL1200406
For the given ligand Captagon, we have found in our database that, being scored 0.5857143, the most similar ligand is CHEMBL1200406. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL1200406 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | CN(C)CCOC(c1ccccc1)c2ccccc2.CN3C(=O)N(C)c4nc(Cl)[nH]c4C3=O |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 0000802a 04801800 00080100 82010600 000800d0 0000c000 00008000 01000000 06400100 800808e0 0c20900c 40809000 03009008 00410000 c0281088 020c000c 00800000 02008000 00400000 00002000 80000100 18000160 33800041 00700014 10040400 e0202000 60080000 40040000 00004280 00460002 c0002000 00020680 |