On Target DRD1_HUMAN 0.4519774/CHEMBL370364
For the given ligand Captagon, we have found in our database that, being scored 0.4519774, the most similar ligand is CHEMBL370364. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL370364 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | Cc1ccc(cc1)c2cc3C(=O)N(CCN4CCN(CC4)c5ccccc5Cl)C(=O)Nc3[nH]2 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 0000e002 00800c00 00080120 56010600 00180020 0000c000 00001000 08080400 06200101 90000ae0 0420900c 40018800 02019806 00f02000 003208c0 080c000c 00060000 1200e004 0c600000 10400002 c0100000 38008170 31806063 02710006 0e042000 c0000400 60000000 000400c0 0840c004 00460450 c0080a00 40020e80 |