On Target DRD5_HUMAN 0.3877551/CHEMBL238718
For the given ligand Captagon, we have found in our database that, being scored 0.3877551, the most similar ligand is CHEMBL238718. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL238718 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | Clc1ccc(cc1)N2CCN(CCCCN3C=Nc4ccccc4C3=O)CC2 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 0000c002 00000000 00100020 04000600 000c0000 00004060 00000000 20000000 06200100 c0000ae0 0120000c 40038800 02009006 00e02000 000000c0 000c0004 00040000 00008000 08600000 00000201 c0100000 38000138 21800061 02300012 00002000 80000000 20080100 10040080 0800c000 00460000 40080000 02020280 |