On Target NPY1R_HUMAN 0.37790698/CHEMBL421770
For the given ligand Captagon, we have found in our database that, being scored 0.37790698, the most similar ligand is CHEMBL421770. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL421770 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | Cc1cccc2c1nc(COc3ccc(Cl)cc3)n2CCCC4CCN(CCc5ccccc5)CC4 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 04008002 01000808 22120108 10050610 000c5060 0000c040 02000000 20000000 00000380 000818d0 0920800c 50018800 02801006 00c08000 010200c1 020e000c 04008000 02880400 00602000 40020201 c0000000 18200170 a1800007 81500110 00042000 c0000020 00100040 10000000 04000204 00460802 c0080004 000226a0 |