On Target CCKAR_HUMAN 0.3254717/CHEMBL1172252
For the given ligand Captagon, we have found in our database that, being scored 0.3254717, the most similar ligand is CHEMBL1172252. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL1172252 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | CCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](Cc3ccc4ccccc4c3)NC(=O)[C@H](Cc5cnc[nH]5)NC(=O)[C@H](Cc6ccccc6)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@@H](N)Cc7ccc(O)cc7)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc8ccccc8)C(=O)N |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 04070002 01003a08 20100100 45810e10 04141240 00000000 02002020 2000200c 00600b80 00090ac2 28308004 5003b800 1e00981a 00502801 81020040 001c000c 00000000 0e000001 00e02418 40020201 60000d00 38358e38 21800083 93500018 00043801 80000200 48120000 10000100 0c000016 0046000b e00c4200 20802e20 |