On Target AA3R_HUMAN 0.65957445/CHEMBL464437
For the given ligand Captagon, we have found in our database that, being scored 0.65957445, the most similar ligand is CHEMBL464437. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL464437 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | CN(C)CCN1C(=O)N(Cc2ccccc2)c3nc4[nH]c(C)cn4c3C1=O |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 0000002a 00801a00 00080100 42010710 00180040 0000c040 00008004 00001000 06700101 800008e0 0d20900c 40018800 00009800 01d00000 002a0880 080c100c 08800000 0200c000 00400000 40000000 80020180 38008040 21800041 81700104 1c040000 c0200000 68008000 00040004 0c004004 00460018 c00c0000 02000e80 |