On Target CXCR2_HUMAN 0.33505154/CHEMBL403877
For the given ligand Captagon, we have found in our database that, being scored 0.33505154, the most similar ligand is CHEMBL403877. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL403877 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | C[C@H](CO)Nc1nc(SCc2cccc(F)c2F)nc3NC(=O)C(=O)Nc13 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 0001002a 00808900 00183520 0a192621 000000c0 0800c010 00008106 00001900 06420100 000068e0 0d200004 50009100 04009800 40041000 00ac0001 100c000d 0c041208 06004100 80400020 00200000 00140581 18048240 23804040 00e80814 00000002 d0308000 d8008408 000000a9 0408400c 00468000 c0001000 000122c0 |