On Target AA2BR_HUMAN 0.39823008/CHEMBL334325
For the given ligand Aspirin, we have found in our database that, being scored 0.39823008, the most similar ligand is CHEMBL334325. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL334325 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1cccc(c1)N2CCN(CCOC(=O)c3cc(Cl)c(N)cc3OC)CC2 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 0000c002 90000808 20000328 84090600 00001090 00024000 06000000 00000800 00000100 00000a40 00201004 40008800 02008006 08012000 81101049 02082008 10060880 02000400 08000000 00022400 40100000 28020b20 32000020 02400006 00002400 80002400 00180800 00000081 08808300 00060800 c0004000 00020200 |