On Target NPSR1_HUMAN 0.19827586/CHEMBL3086828
For the given ligand Aspirin, we have found in our database that, being scored 0.19827586, the most similar ligand is CHEMBL3086828. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3086828 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | O=C1c2ccccc2C(=O)C1(N3CCN(Cc4ccccc4)CC3)c5ccccc5 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00000000 01000800 00100102 04010600 00000020 00008000 00000000 02001000 00000980 00090840 08300000 4000b000 07008802 00203001 40000400 00020000 00000200 02000000 00100008 00000201 00c00100 38328240 00404021 83400014 00000800 c0000001 00000000 80000000 0c000100 00060002 80046000 00000700 |