On Target HRH3_HUMAN 0.4512195/CHEMBL544242
For the given ligand Aspirin, we have found in our database that, being scored 0.4512195, the most similar ligand is CHEMBL544242. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL544242 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | Cl.CCN(CC)Cc1ccc(COc2ccc(cc2)C(=O)C)cc1 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04000000 00000808 20000109 00050600 00001000 00004000 02040000 02001000 00000100 00080840 08200000 40008000 80808802 00010000 01000401 02080008 00000000 02000000 00000000 00020000 00000000 08028220 00000000 00c01014 00000000 c0002000 00120000 80000000 00000300 00060002 c0040000 00020600 |