On Target HRH4_HUMAN 0.33962265/CHEMBL14638
For the given ligand Aspirin, we have found in our database that, being scored 0.33962265, the most similar ligand is CHEMBL14638. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL14638 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | O=C(C1CC1)c2ccc(OCCCc3c[nH]cn3)cc2 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04000002 01000808 2000010b 00810310 04001040 02000000 02042000 00000000 00400900 00080840 28108000 40019800 04808002 01300800 11020001 000c200c 00000000 06000000 00400008 40020001 00000500 08020200 210000c0 00400014 00040001 82000200 00120000 00000000 00000204 00420002 c0000000 20000400 |