On Target 5HT6R_HUMAN 0.37623763/CHEMBL631
For the given ligand Aspirin, we have found in our database that, being scored 0.37623763, the most similar ligand is CHEMBL631. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL631 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CCCNCC(O)COc1ccccc1C(=O)CCc2ccccc2 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04000000 01000808 2010010a 00010600 00001080 82020000 02000000 00000200 00000810 00080840 08300000 40009060 04808002 00200000 01280001 000a2008 10200000 22008000 00800008 00020201 00000100 18020200 07000080 08400414 00000801 c0000000 00000800 00800000 00000300 00064002 80000000 00002640 |