On Target CXCR2_HUMAN 0.34453782/CHEMBL3645131
For the given ligand Aspirin, we have found in our database that, being scored 0.34453782, the most similar ligand is CHEMBL3645131. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3645131 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CC(CCc1ccccc1)Oc2c(ccc3ccccc23)C(=O)NC4(CCCC4)C(=O)O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04018008 01005808 2010010a 00010700 00081080 02020100 02000000 22001400 00000800 001808c0 08300000 4001b020 0680880a 00a00000 11000401 00082008 10000000 22008000 00402000 00020201 00000140 18068e08 03000040 0050001c 00000000 c0000000 00000800 90000000 00000300 01060003 a4044000 00000600 |