On Target EDNRA_HUMAN 0.38194445/CHEMBL1793932
For the given ligand fentanyl, we have found in our database that, being scored 0.38194445, the most similar ligand is CHEMBL1793932. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL1793932 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)[C@@H](C)CC)C(=O)NCC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00050002 01003e00 00100100 45810610 000c1200 00000000 00002000 2100000c 00400880 000909e0 08300004 4001b000 1e008812 01402801 80000040 000c000c 00000000 02000001 00e00418 00000201 40000100 383c8e08 21800083 83500018 00043801 a0000000 08000000 50000000 0c000082 0006001b 20044200 00002620 |