On Target NK2R_HUMAN 0.5081967/CHEMBL108997
For the given ligand fentanyl, we have found in our database that, being scored 0.5081967, the most similar ligand is CHEMBL108997. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL108997 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CC(=O)Nc1ccc(CN2CCC(CC2)NCC(=O)N3CCN(C[C@H]3c4ccc(Cl)c(Cl)c4)C(=O)c5cc(C)cc(C)c5)cc1 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 0000c002 0d803c00 00100100 84010600 00000001 00000000 14000000 2200100c 00000080 000909e8 08280004 5001a800 02008866 0010a000 80000440 08000008 00040000 02000000 08000000 00000201 c0100000 38228700 20002023 8358001c 00002000 c0100000 08040000 90000080 0c008100 00060013 a0044000 00020600 |