On Target GRM7_HUMAN 0.30136988/CHEMBL3559748
For the given ligand fentanyl, we have found in our database that, being scored 0.30136988, the most similar ligand is CHEMBL3559748. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL3559748 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CCn1c(C)cc(C(=O)CSc2ccc(NC(=O)C)cc2)c1C |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00004002 00803a00 00120100 50100619 00014060 40008800 00002000 0000000c 00420100 010a48d0 00680004 60018000 00018000 00348000 020200c0 080c000c 04040400 82800004 08200400 00000000 c4100000 18048610 20806001 0650001d 00042000 40000000 08000000 148010d0 00008006 00060043 90000200 01010220 |