On Target HRH4_HUMAN 0.4368932/CHEMBL4084275
For the given ligand fentanyl, we have found in our database that, being scored 0.4368932, the most similar ligand is CHEMBL4084275. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL4084275 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | OC(=O)C(Cc1cccc2ccccc12)NC(=O)[C@@H](CS)Cc3ccccc3 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00000000 00005200 00100100 00110600 00000080 00000000 00000000 20000004 00000880 000808c0 08300000 4000b000 06008002 00040000 80080000 000c0008 10000000 02000000 00400008 00400201 60000100 18200e08 03000340 81400018 00000800 80000000 00000000 10000000 04000000 0006003b 20004000 01012600 |