On Target 5HT6R_HUMAN 0.6593407/CHEMBL3260790
For the given ligand fentanyl, we have found in our database that, being scored 0.6593407, the most similar ligand is CHEMBL3260790. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL3260790 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | O=C1CC(CN1c2cccc(c2)C3CCNCC3)c4ccccc4 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00024002 01001200 40100100 00010600 24000000 00002010 00000000 20000004 00400880 000808d0 08380004 50019000 04008002 00100800 00020040 00040000 00040000 02000000 08000008 00000201 44100100 18200600 20002000 81400019 00040800 80000000 00000000 10000080 04408000 0006000b 00000000 00800600 |