On Target GRM7_HUMAN 0.49/CHEMBL432038
For the given ligand Gingerol, we have found in our database that, being scored 0.49, the most similar ligand is CHEMBL432038. Check out the elaboration below.
| Gingerol (Given Ligand) | CHEMBL432038 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | N[C@@](CC1c2ccccc2Oc3ccccc13)([C@H]4C[C@@H]4C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00030000 01000208 2000010a 00018600 00181000 00000000 02000000 01000200 00000804 000a08c0 08100000 4001b040 0400803a 03a00000 01000001 00082008 00000000 02000000 00402000 00020001 00400100 18000a00 03000000 06400410 00000000 e0000000 00000000 40200000 00000382 0006c00a 02020400 00400400 |