On Target AA2BR_HUMAN 0.03731343/CHEMBL51353
For the given ligand S protein, we have found in our database that, being scored 0.03731343, the most similar ligand is CHEMBL51353. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL51353 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | Cn1c(nc2c(N)nc(nc12)C#CC3(O)CCCCC3)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 0000c20a 01889800 00080508 180906a0 0148a060 0000c000 00209000 000a0800 10400100 100018c1 0000808c 40009808 02001004 00900000 000a0080 180d000c 00000008 02002000 02402002 80600001 80100008 38000140 21802840 00400014 00202000 c1000000 40040000 00000020 0000000d 00660e40 c0020804 0a0280c0 |