On Target ADRB2_HUMAN 0.04494382/CHEMBL1940828
For the given ligand S protein, we have found in our database that, being scored 0.04494382, the most similar ligand is CHEMBL1940828. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL1940828 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | OCc1cc(ccc1O)C(O)CNCCc2ccc(NCC(O)c3ccc(cc3)c4ccccc4)cc2 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00006002 00000808 20101100 40050600 20001081 00004000 02000000 00000800 00000180 00080840 a8200004 40008800 00000002 00008000 000a0040 00082008 10060000 02000000 0c000000 50020200 40100000 18200020 32000000 81400011 00000000 80000000 08520000 000000c0 0400c000 00060002 40000000 00002600 |