On Target 5HT1D_HUMAN 0.04411765/CHEMBL276868
For the given ligand S protein, we have found in our database that, being scored 0.04411765, the most similar ligand is CHEMBL276868. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL276868 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CC(C)(C)c1ccc(cc1)C2=NCCN2 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00000000 00040000 00200100 08010600 40000000 00000000 10000000 02001000 00000100 00090843 18200010 40008800 80000802 00008008 00040400 00180000 00000800 02000000 00000000 00000000 00200000 28008000 00000000 02400010 00000080 c0000000 40000000 80000000 08000118 00068002 40040080 00000600 |