On Target CCR5_HUMAN 0.09/CHEMBL62454
For the given ligand S protein, we have found in our database that, being scored 0.09, the most similar ligand is CHEMBL62454. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL62454 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | [Cl-].CCCC[P+](CCCC)(CCCC)Cc1ccc(NC(=O)\C=C\c2cccc(c2)c3ccc(C)cc3)cc1 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00006202 00008a00 00000100 00010600 00000001 00000000 80000080 44000400 01800500 00400840 00280005 60108008 00008200 00118000 02010042 00000008 22061408 02001100 0c018000 10800201 40100000 08000600 30082000 20400010 00000000 80010002 00402000 400100c1 0040c200 00260301 14000000 0002c200 |