On Target ADRB3_HUMAN 0.044692736/CHEMBL417387
For the given ligand S protein, we have found in our database that, being scored 0.044692736, the most similar ligand is CHEMBL417387. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL417387 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CCCCCCP(=O)(O)COc1ccc(C[C@@H](C)NC[C@H](O)COc2ccc(O)c3NC(=O)CCc23)cc1 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 04004802 c3100a08 20100108 41010600 30001080 c6002040 06040000 00000200 00000890 000808c0 08380024 40109040 04808012 09130000 032a8041 000c6008 122480ac 22108000 08806008 00022601 40100100 19740600 27402080 89488410 08000801 c1000000 211a0050 19c15080 64048300 0006830b 10040400 2202e645 |