On Target TAAR1_HUMAN 0.07692308/CHEMBL1255743
For the given ligand S protein, we have found in our database that, being scored 0.07692308, the most similar ligand is CHEMBL1255743. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL1255743 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | Cl.N[C@@H]1C[C@H]1c2ccccc2 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00000000 00000200 00000100 00010600 00000000 00000000 00000000 00000000 00000800 000808c0 08100000 40008000 00000000 01000000 00000000 00000000 00000000 02000000 00000000 00000001 00000100 18000000 00000000 81400010 00000000 80000000 00000000 00000000 04000000 0006000a 00000000 00020400 |