On Target CXCR3_HUMAN 0.04347826/CHEMBL2181446
For the given ligand S protein, we have found in our database that, being scored 0.04347826, the most similar ligand is CHEMBL2181446. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL2181446 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | [I-].CC1(C)[C@H]2CC[C@@H](C[N+](C)(C)Cc3ccc(cc3)c4ccccc4I)[C@@H]1C2 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00002000 01000000 00180100 00010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80000842 02000010 00000400 00000000 00020000 02000000 06002100 10000201 00010040 18008010 10000000 00580010 00000000 c0000000 00000010 98000040 00004100 00060000 20260000 00000200 |