On Target CNR1_HUMAN 0.056338027/CHEMBL2179762
For the given ligand S protein, we have found in our database that, being scored 0.056338027, the most similar ligand is CHEMBL2179762. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL2179762 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | Cc1ccc(cc1)C(NC(=O)Cc2ccccc2)NC(=O)Cc3ccccc3 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00000000 01800000 00100100 00010e00 00000000 00000000 00000004 02003000 00000180 00080840 08200000 40009000 81009802 00000000 40000400 00000000 00000008 02000000 00000040 00000201 80000100 18218600 00000000 81400018 00010000 c0000000 00000000 80000000 04000100 00060203 20042000 00000600 |