On Target GRM1_HUMAN 0.046511628/CHEMBL38499
For the given ligand S protein, we have found in our database that, being scored 0.046511628, the most similar ligand is CHEMBL38499. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL38499 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | N[C@@H](CC(=C)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00030000 81000000 00000000 00000400 00180000 00000000 00080000 00000400 01000000 00120080 00000000 40003000 04008020 02000000 00000000 00080008 00000000 00000000 00400010 00000001 00000000 10000a00 03000000 00000010 00000000 00000000 00000000 80000000 00000000 80040000 04000000 00000000 |