On Target AGTR2_HUMAN 0.038961038/CHEMBL2435831
For the given ligand S protein, we have found in our database that, being scored 0.038961038, the most similar ligand is CHEMBL2435831. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL2435831 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CCCCNC(=O)c1cc(C)c2nc(CCC)n(Cc3ccc(cc3)c4ccccc4C(=O)O)c2c1 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 0800a00a 00809a01 00101500 10050610 000c0061 0000c000 10000000 22001004 80500100 100018d0 0120800c 40818800 82009882 00608000 200304c0 0a0c000c 00020008 06800004 04680008 50010201 c0000000 18068e30 31800041 8150041c 00044000 c0000000 08000040 90000040 04404104 00c60809 e00c8004 200006a0 |