On Target DRD4_HUMAN 0.051282052/CHEMBL1202208
For the given ligand S protein, we have found in our database that, being scored 0.051282052, the most similar ligand is CHEMBL1202208. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL1202208 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | Br.Cc1ccc(N2CCN(C[C@@H]3C[C@H]3c4ccccc4)CC2)c(C)c1 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00004002 01000a00 00100122 04010600 00000001 00000040 00000000 20000000 00100800 00080ac0 08300004 40018000 00000002 0120a000 00020040 00040008 00240000 02000000 08000000 00000201 40100100 38000000 20000021 02500012 00000000 80000000 00000000 10001080 08008000 0006000a 00000008 00000600 |