On Target TSHR_HUMAN 0.03809524/CHEMBL3891546
For the given ligand S protein, we have found in our database that, being scored 0.03809524, the most similar ligand is CHEMBL3891546. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL3891546 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CC(=O)N1c2ccc(cc2C(C)(CC1(C)C)c3ccccc3)C(=O)N |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00004002 01001a00 00100102 80010600 20000021 00082040 01000000 21001000 00000800 00080ac0 08380024 40008200 00008802 00308000 00020040 080c0008 00048000 02000001 08000408 00000201 40100100 18068600 21002000 0040001c 00000000 a1000000 08000010 50001080 00088080 0006000b 80040080 20000600 |