On Target OPRD_HUMAN 0.052083332/CHEMBL106880
For the given ligand S protein, we have found in our database that, being scored 0.052083332, the most similar ligand is CHEMBL106880. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL106880 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)N2CN(CC2=O)C(=O)CNC(=O)[C@@H](N)Cc3ccc(O)cc3)C(=O)N |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00010000 01003208 20100100 04010e00 00000000 00000000 02000004 2000200c 00000880 000a08c0 08300000 4001b000 0600b002 00002001 80000000 00040008 00000018 02002000 00000048 00020201 00000100 38250600 00000003 83400018 00010800 80000000 00120000 10000000 0c000000 0006020b 20004000 00002600 |