On Target CCR2_HUMAN 0.058252428/CHEMBL248812
For the given ligand S protein, we have found in our database that, being scored 0.058252428, the most similar ligand is CHEMBL248812. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL248812 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CN(C)c1ccc(cc1)C2CCN(CC3CCN(CC3)C(=O)\C=C\c4ccc(Cl)c(Cl)c4)CC2 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00008002 01009a00 00100100 40010600 00000000 00000000 84100080 20000400 01a00800 004a08c0 08300004 50038800 02008006 00018000 80000042 00040000 20040400 02000100 08018000 00800201 40000100 18040700 20000000 00500018 00002000 80100000 004c2000 50010080 00408000 0006030b 04000000 02022600 |