On Target MC5R_HUMAN 0.039215688/CHEMBL1761870
For the given ligand S protein, we have found in our database that, being scored 0.039215688, the most similar ligand is CHEMBL1761870. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL1761870 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | C[C@@H]1CN(C[C@H](C)N1)C(=O)N[C@H](Cc2ccc(F)cc2)C(=O)N3CCC(CC3)(C4CCCCC4)C(=O)NC(C)(C)C |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00030000 01003200 00100100 06010e00 00000000 00000010 00000004 2000200c 00200800 000a08c0 08300000 5003b000 0400b00a 00003000 00000000 00040000 00000018 02000080 02002048 00100201 00000100 38250610 00000021 83500018 00010800 80000000 00000000 10000001 0c000000 0006800b 20024000 00802600 |