On Target GRM6_HUMAN 0.09375/CHEMBL280563
For the given ligand CCCC, we have found in our database that, being scored 0.09375, the most similar ligand is CHEMBL280563. Check out the elaboration below.
| CCCC (Given Ligand) | CHEMBL280563 (Similar Ligand) |
|---|---|
| CCCC | N[C@@H]([C@H]1C[C@@H]1C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00020080 00000000 40013000 04008038 03800000 00000000 00080008 00000000 00000000 00402000 00000001 00000000 10000a00 03000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00000000 00000000 |