On Target ADRB2_HUMAN 0.05357143/CHEMBL388177
For the given ligand CCCC, we have found in our database that, being scored 0.05357143, the most similar ligand is CHEMBL388177. Check out the elaboration below.
| CCCC (Given Ligand) | CHEMBL388177 (Similar Ligand) |
|---|---|
| CCCC | C[C@H](Cc1cccc2ccccc12)NC[C@@H](O)c3cc(O)cc(O)c3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000001 4a000008 20100100 00010600 00000080 80004000 02000000 00000000 00000980 00080840 08300000 40008000 00000002 00000000 00080000 00080008 10000000 02000000 00000000 00020a01 00000100 18200028 02000000 81400010 00000000 80000000 00000000 00000000 04000000 00060002 40000000 00002600 |