On Target CCR4_HUMAN 0.034883723/CHEMBL1621896
For the given ligand CCCC, we have found in our database that, being scored 0.034883723, the most similar ligand is CHEMBL1621896. Check out the elaboration below.
| CCCC (Given Ligand) | CHEMBL1621896 (Similar Ligand) |
|---|---|
| CCCC | COc1ccc(Br)cc1CN2CCCC(C2)C(=O)N3CCCCC3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00014000 21009408 20100108 00010600 00001000 00000100 02000000 22001400 40000000 001009e0 08200000 d0019000 0c008812 00000000 01000501 00002008 00000000 02000000 00000010 00020201 00000000 18048620 00008000 00500018 00001000 c0000000 00420000 90000000 00000300 00060011 24040008 08002200 |