On Target NPBW1_HUMAN 0.023255814/CHEMBL1999570
For the given ligand CCCC, we have found in our database that, being scored 0.023255814, the most similar ligand is CHEMBL1999570. Check out the elaboration below.
| CCCC (Given Ligand) | CHEMBL1999570 (Similar Ligand) |
|---|---|
| CCCC | COc1ccc(SC2=C(Cl)C(=O)N(Cc3cccc4ccccc34)N=C2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010004 01804608 60120108 00110608 001c1040 00008000 02028000 10001000 06100000 800008c0 00200008 71018c00 0600980b 80e00000 11040001 000d000c 0c001008 02004000 02200410 00220101 90000000 1c018118 01800881 83700019 04100000 800c0000 00808000 00040100 04000200 00060008 00040040 00930230 |