On Target DRD4_HUMAN 0.057692308/CHEMBL21035
For the given ligand CCCC, we have found in our database that, being scored 0.057692308, the most similar ligand is CHEMBL21035. Check out the elaboration below.
| CCCC (Given Ligand) | CHEMBL21035 (Similar Ligand) |
|---|---|
| CCCC | CC(C)(C)C(=O)NCCCCN1CCN(CC1)c2ccccc2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004002 00001000 00100020 04000600 00000000 00000000 00000000 20000000 00200000 00000ac0 00200004 40029000 00008002 00002000 00000040 00000000 00040000 00000000 08000000 00000201 40100000 38040600 20000021 0200001a 00000000 00000000 00000000 10000080 08008000 00060001 00000000 00002200 |