On Target ACM5_HUMAN 0.30769232/CHEMBL305660
For the given ligand HU-580, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL305660. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL305660 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CC(C)(C)c1ccc(cc1)C(=O)CCCN2CCC(CC2)OC(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00020000 01000800 00100102 40010600 00000010 00004000 00000000 21000000 00100900 000808c0 08300000 50019800 04008002 00290000 00000000 02080008 00200000 02000000 00800000 00000201 00000120 18020220 01000080 00500014 00000401 a0002000 00080000 50000000 00000280 00060002 c0000000 02802600 |