On Target ACM5_HUMAN 0.29411766/CHEMBL170221
For the given ligand CBDA, we have found in our database that, being scored 0.29411766, the most similar ligand is CHEMBL170221. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL170221 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CC(C1=C(CCN(C)C)Cc2ccccc12)c3ccccc3 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00080000 09000000 00100303 00010600 02000000 00800002 80080081 00000403 00100800 00b808c0 08300000 41018000 00000000 00200000 00000022 00000000 00000400 02100040 00200000 00000801 00100100 18100000 0040c000 00500010 01000000 80000001 00402000 50000000 00400000 00060c02 04000000 00000700 |